C20H40N2O5 — CID 160748573
2-ethylbutanoic acid;2-ethyl-1-morpholin-4-ylbutan-1-one;morpholine (PubChem CID 160748573) has the molecular formula C20H40N2O5 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-ethylbutanoic acid;2-ethyl-1-morpholin-4-ylbutan-1-one;morpholine.
| Compound Name | 2-ethylbutanoic acid;2-ethyl-1-morpholin-4-ylbutan-1-one;morpholine |
|---|---|
| PubChem CID | 160748573 |
| Molecular Formula | C20H40N2O5 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | 2-ethylbutanoic acid;2-ethyl-1-morpholin-4-ylbutan-1-one;morpholine |
| SMILES | C1COCCN1.CCC(CC)C(=O)N1CCOCC1.CCC(CC)C(=O)O |
| InChI | InChI=1S/C10H19NO2.C6H12O2.C4H9NO/c1-3-9(4-2)10(12)11-5-7-13-8-6-11;1-3-5(4-2)6(7)8;1-3-6-4-2-5-1/h9H,3-8H2,1-2H3;5H,3-4H2,1-2H3,(H,7,8);5H,1-4H2 |
| InChIKey | RWMZECQFTMHONE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |