About 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde
2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde (PubChem CID 160749590) has the molecular formula C23H22N4O
and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde |
| PubChem CID | 160749590 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde |
| SMILES | CC(C#N)=Cc1ccncc1.CC=Cc1ccncc1.O=Cc1ccncc1 |
| InChI | InChI=1S/C9H8N2.C8H9N.C6H5NO/c1-8(7-10)6-9-2-4-11-5-3-9;1-2-3-8-4-6-9-7-5-8;8-5-6-1-3-7-4-2-6/h2-6H,1H3;2-7H,1H3;1-5H |
| InChIKey | RWQIKRQTXVKRFC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde?
The IUPAC name of 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde (CID 160749590) is 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde.
What is the SMILES notation for 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde?
The canonical SMILES for 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde is CC(C#N)=Cc1ccncc1.CC=Cc1ccncc1.O=Cc1ccncc1.
What is the InChIKey of 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde?
The InChIKey is RWQIKRQTXVKRFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C8H9N.C6H5NO/c1-8(7-10)6-9-2-4-11-5-3-9;1-2-3-8-4-6-9-7-5-8;8-5-6-1-3-7-4-2-6/h2-6H,1H3;2-7H,1H3;1-5H.
What are the key properties of 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde?
2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde has a molecular weight of 370.46 g/mol, XLogP of 5.02, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-pyridin-4-ylprop-2-enenitrile;4-prop-1-enylpyridine;pyridine-4-carbaldehyde is sourced from PubChem (CID 160749590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).