About tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate
tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate (PubChem CID 160749919) has the molecular formula C15H25N3O4S3
and a molecular weight of 407.58 g/mol. Its IUPAC name is tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate |
| PubChem CID | 160749919 |
| Molecular Formula | C15H25N3O4S3 |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCSc2ncc(S(N)(=O)=O)s2)CC1 |
| InChI | InChI=1S/C15H25N3O4S3/c1-15(2,3)22-14(19)18-7-4-11(5-8-18)6-9-23-13-17-10-12(24-13)25(16,20)21/h10-11H,4-9H2,1-3H3,(H2,16,20,21) |
| InChIKey | RWRFWVRSLHJLRI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate (CID 160749919) is tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(CCSc2ncc(S(N)(=O)=O)s2)CC1.
What is the InChIKey of tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate?
The InChIKey is RWRFWVRSLHJLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O4S3/c1-15(2,3)22-14(19)18-7-4-11(5-8-18)6-9-23-13-17-10-12(24-13)25(16,20)21/h10-11H,4-9H2,1-3H3,(H2,16,20,21).
What are the key properties of tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate?
tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate has a molecular weight of 407.58 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[2-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]ethyl]piperidine-1-carboxylate is sourced from PubChem (CID 160749919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).