About (3-chlorophenyl)urea
(3-chlorophenyl)urea (PubChem CID 16075) has the molecular formula C7H7ClN2O
and a molecular weight of 170.60 g/mol. Its IUPAC name is (3-chlorophenyl)urea.
Molecular Properties
| Compound Name | (3-chlorophenyl)urea |
| PubChem CID | 16075 |
| Molecular Formula | C7H7ClN2O |
| Molecular Weight | 170.60 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | (3-chlorophenyl)urea |
| SMILES | NC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C7H7ClN2O/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| InChIKey | PPCUBWWPGYHEJE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.60 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-chlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)urea?
The IUPAC name of (3-chlorophenyl)urea (CID 16075) is (3-chlorophenyl)urea.
What is the SMILES notation for (3-chlorophenyl)urea?
The canonical SMILES for (3-chlorophenyl)urea is NC(=O)Nc1cccc(Cl)c1.
What is the InChIKey of (3-chlorophenyl)urea?
The InChIKey is PPCUBWWPGYHEJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11).
What are the key properties of (3-chlorophenyl)urea?
(3-chlorophenyl)urea has a molecular weight of 170.60 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)urea is sourced from PubChem (CID 16075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).