C13H9F6N3O5 — CID 160750963
2,2,2-trifluoroacetate;3-[4-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 160750963) has the molecular formula C13H9F6N3O5 and a molecular weight of 401.22 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;3-[4-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 2,2,2-trifluoroacetate;3-[4-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 160750963 |
| Molecular Formula | C13H9F6N3O5 |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2,2,2-trifluoroacetate;3-[4-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | O=C(O)CC[n+]1ccc(-c2nc(C(F)(F)F)co2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H8F3N3O3.C2HF3O2/c12-11(13,14)8-6-20-10(16-8)7-1-3-17(15-5-7)4-2-9(18)19;3-2(4,5)1(6)7/h1,3,5-6H,2,4H2;(H,6,7) |
| InChIKey | KRIIZBAVIOUPKR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 120.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|