About dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide
dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide (PubChem CID 160751688) has the molecular formula C7H13Cl2NPt
and a molecular weight of 377.17 g/mol. Its IUPAC name is dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide.
Molecular Properties
| Compound Name | dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide |
| PubChem CID | 160751688 |
| Molecular Formula | C7H13Cl2NPt |
| Molecular Weight | 377.17 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide |
| SMILES | Cl[Pt+2]Cl.[CH2-][C@@H]1CCCC[C@@H]1[NH-] |
| InChI | InChI=1S/C7H13N.2ClH.Pt/c1-6-4-2-3-5-7(6)8;;;/h6-8H,1-5H2;2*1H;/q-2;;;+4/p-2/t6-,7+;;;/m1.../s1 |
| InChIKey | RWXFVVYREIQIOE-YEIXYONGSA-L |
| XLogP | 3.81 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide?
The IUPAC name of dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide (CID 160751688) is dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide.
What is the SMILES notation for dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide?
The canonical SMILES for dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide is Cl[Pt+2]Cl.[CH2-][C@@H]1CCCC[C@@H]1[NH-].
What is the InChIKey of dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide?
The InChIKey is RWXFVVYREIQIOE-YEIXYONGSA-L. The full InChI is InChI=1S/C7H13N.2ClH.Pt/c1-6-4-2-3-5-7(6)8;;;/h6-8H,1-5H2;2*1H;/q-2;;;+4/p-2/t6-,7+;;;/m1.../s1.
What are the key properties of dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide?
dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide has a molecular weight of 377.17 g/mol, XLogP of 3.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum(2+);[(1S,2R)-2-methanidylcyclohexyl]azanide is sourced from PubChem (CID 160751688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).