About 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine
2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine (PubChem CID 160752534) has the molecular formula C12H23BrF2N4O
and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine.
Molecular Properties
| Compound Name | 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine |
| PubChem CID | 160752534 |
| Molecular Formula | C12H23BrF2N4O |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine |
| SMILES | CN1CCN(C(=O)C(F)(F)Br)CC1.CN1CCNCC1 |
| InChI | InChI=1S/C7H11BrF2N2O.C5H12N2/c1-11-2-4-12(5-3-11)6(13)7(8,9)10;1-7-4-2-6-3-5-7/h2-5H2,1H3;6H,2-5H2,1H3 |
| InChIKey | RXAAFWUVLBVXQU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine?
The IUPAC name of 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine (CID 160752534) is 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine.
What is the SMILES notation for 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine?
The canonical SMILES for 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine is CN1CCN(C(=O)C(F)(F)Br)CC1.CN1CCNCC1.
What is the InChIKey of 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine?
The InChIKey is RXAAFWUVLBVXQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrF2N2O.C5H12N2/c1-11-2-4-12(5-3-11)6(13)7(8,9)10;1-7-4-2-6-3-5-7/h2-5H2,1H3;6H,2-5H2,1H3.
What are the key properties of 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine?
2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine has a molecular weight of 357.24 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2,2-difluoro-1-(4-methylpiperazin-1-yl)ethanone;1-methylpiperazine is sourced from PubChem (CID 160752534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).