C23H46O6 — CID 160752917
butane-1,4-diol;2-octanoyloxypropyl octanoate (PubChem CID 160752917) has the molecular formula C23H46O6 and a molecular weight of 418.62 g/mol. Its IUPAC name is butane-1,4-diol;2-octanoyloxypropyl octanoate.
| Compound Name | butane-1,4-diol;2-octanoyloxypropyl octanoate |
|---|---|
| PubChem CID | 160752917 |
| Molecular Formula | C23H46O6 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | butane-1,4-diol;2-octanoyloxypropyl octanoate |
| SMILES | CCCCCCCC(=O)OCC(C)OC(=O)CCCCCCC.OCCCCO |
| InChI | InChI=1S/C19H36O4.C4H10O2/c1-4-6-8-10-12-14-18(20)22-16-17(3)23-19(21)15-13-11-9-7-5-2;5-3-1-2-4-6/h17H,4-16H2,1-3H3;5-6H,1-4H2 |
| InChIKey | RXBGAKUROVNBOV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|