C16H16N2O4 — CID 160753589
(2R,6E)-6-[(5-formyl-2-pyridinyl)methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 160753589) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is (2R,6E)-6-[(5-formyl-2-pyridinyl)methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2R,6E)-6-[(5-formyl-2-pyridinyl)methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 160753589 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2R,6E)-6-[(5-formyl-2-pyridinyl)methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)CC2/C(=C\c3ccc(C=O)cn3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C16H16N2O4/c1-16(2)6-12-11(14(20)18(12)13(16)15(21)22)5-10-4-3-9(8-19)7-17-10/h3-5,7-8,12-13H,6H2,1-2H3,(H,21,22)/b11-5+/t12?,13-/m0/s1 |
| InChIKey | WAGMEOZICCQPNO-HVJKLJFUSA-N |
| XLogP | 1.37 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|