C17H21N5O3 — CID 160753594
(2R,6E)-6-[[5-[(diaminomethylideneamino)methyl]-2-pyridinyl]methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 160753594) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is (2R,6E)-6-[[5-[(diaminomethylideneamino)methyl]-2-pyridinyl]methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2R,6E)-6-[[5-[(diaminomethylideneamino)methyl]-2-pyridinyl]methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 160753594 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2R,6E)-6-[[5-[(diaminomethylideneamino)methyl]-2-pyridinyl]methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)CC2/C(=C\c3ccc(CN=C(N)N)cn3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C17H21N5O3/c1-17(2)6-12-11(14(23)22(12)13(17)15(24)25)5-10-4-3-9(7-20-10)8-21-16(18)19/h3-5,7,12-13H,6,8H2,1-2H3,(H,24,25)(H4,18,19,21)/b11-5+/t12?,13-/m0/s1 |
| InChIKey | WABMFHIUEXQEQP-HVJKLJFUSA-N |
| XLogP | 0.33 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|