C25H20N10S — CID 160756166
2-isothiocyanato-7-(1-methylpyrazol-4-yl)-1,5-naphthyridine;7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-2-amine (PubChem CID 160756166) has the molecular formula C25H20N10S and a molecular weight of 492.57 g/mol. Its IUPAC name is 2-isothiocyanato-7-(1-methylpyrazol-4-yl)-1,5-naphthyridine;7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-2-amine.
| Compound Name | 2-isothiocyanato-7-(1-methylpyrazol-4-yl)-1,5-naphthyridine;7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 160756166 |
| Molecular Formula | C25H20N10S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-isothiocyanato-7-(1-methylpyrazol-4-yl)-1,5-naphthyridine;7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-2-amine |
| SMILES | Cn1cc(-c2cnc3ccc(N)nc3c2)cn1.Cn1cc(-c2cnc3ccc(N=C=S)nc3c2)cn1 |
| InChI | InChI=1S/C13H9N5S.C12H11N5/c1-18-7-10(6-16-18)9-4-12-11(14-5-9)2-3-13(17-12)15-8-19;1-17-7-9(6-15-17)8-4-11-10(14-5-8)2-3-12(13)16-11/h2-7H,1H3;2-7H,1H3,(H2,13,16) |
| InChIKey | RXLQXHYEAJJAFU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|