About 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid
6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid (PubChem CID 160756804) has the molecular formula C19H30NO5P
and a molecular weight of 383.43 g/mol. Its IUPAC name is 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid.
Molecular Properties
| Compound Name | 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid |
| PubChem CID | 160756804 |
| Molecular Formula | C19H30NO5P |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid |
| SMILES | CNC(=O)C(=O)CCCCc1ccccc1CCCCCCP(=O)(O)O |
| InChI | InChI=1S/C19H30NO5P/c1-20-19(22)18(21)14-8-7-13-17-12-6-5-11-16(17)10-4-2-3-9-15-26(23,24)25/h5-6,11-12H,2-4,7-10,13-15H2,1H3,(H,20,22)(H2,23,24,25) |
| InChIKey | IGNGYQGNKNHFKM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid?
The IUPAC name of 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid (CID 160756804) is 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid.
What is the SMILES notation for 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid?
The canonical SMILES for 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid is CNC(=O)C(=O)CCCCc1ccccc1CCCCCCP(=O)(O)O.
What is the InChIKey of 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid?
The InChIKey is IGNGYQGNKNHFKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30NO5P/c1-20-19(22)18(21)14-8-7-13-17-12-6-5-11-16(17)10-4-2-3-9-15-26(23,24)25/h5-6,11-12H,2-4,7-10,13-15H2,1H3,(H,20,22)(H2,23,24,25).
What are the key properties of 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid?
6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid has a molecular weight of 383.43 g/mol, XLogP of 3.00, 13 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[6-(methylamino)-5,6-dioxohexyl]phenyl]hexylphosphonic acid is sourced from PubChem (CID 160756804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).