About 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione
5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 160757550) has the molecular formula C8H10Cl2N4S6
and a molecular weight of 425.50 g/mol. Its IUPAC name is 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione.
Molecular Properties
| Compound Name | 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione |
| PubChem CID | 160757550 |
| Molecular Formula | C8H10Cl2N4S6 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 423.86 |
| IUPAC Name | 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(SCCCl)s1.S=c1[nH]nc(SCCCl)s1 |
| InChI | InChI=1S/2C4H5ClN2S3/c2*5-1-2-9-4-7-6-3(8)10-4/h2*1-2H2,(H,6,8) |
| InChIKey | RXQAKZBBFHAGCO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione?
The IUPAC name of 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione (CID 160757550) is 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione.
What is the SMILES notation for 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione?
The canonical SMILES for 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione is S=c1[nH]nc(SCCCl)s1.S=c1[nH]nc(SCCCl)s1.
What is the InChIKey of 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione?
The InChIKey is RXQAKZBBFHAGCO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H5ClN2S3/c2*5-1-2-9-4-7-6-3(8)10-4/h2*1-2H2,(H,6,8).
What are the key properties of 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione?
5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione has a molecular weight of 425.50 g/mol, XLogP of 5.06, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloroethylsulfanyl)-3H-1,3,4-thiadiazole-2-thione is sourced from PubChem (CID 160757550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).