About 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one
2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one (PubChem CID 160757571) has the molecular formula C7H13BrN2O5S
and a molecular weight of 317.16 g/mol. Its IUPAC name is 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one.
Molecular Properties
| Compound Name | 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one |
| PubChem CID | 160757571 |
| Molecular Formula | C7H13BrN2O5S |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one |
| SMILES | CN1SCCC1=O.O=[N+]([O-])C(Br)(CO)CO |
| InChI | InChI=1S/C4H7NOS.C3H6BrNO4/c1-5-4(6)2-3-7-5;4-3(1-6,2-7)5(8)9/h2-3H2,1H3;6-7H,1-2H2 |
| InChIKey | RXQCFIHEOCCIOC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one?
The IUPAC name of 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one (CID 160757571) is 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one.
What is the SMILES notation for 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one?
The canonical SMILES for 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one is CN1SCCC1=O.O=[N+]([O-])C(Br)(CO)CO.
What is the InChIKey of 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one?
The InChIKey is RXQCFIHEOCCIOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS.C3H6BrNO4/c1-5-4(6)2-3-7-5;4-3(1-6,2-7)5(8)9/h2-3H2,1H3;6-7H,1-2H2.
What are the key properties of 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one?
2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one has a molecular weight of 317.16 g/mol, XLogP of -0.16, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-nitropropane-1,3-diol;2-methyl-1,2-thiazolidin-3-one is sourced from PubChem (CID 160757571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).