C9H10BrNO — CID 160760418
5-bromo-2-methoxy-2,3-dihydro-1H-indole (PubChem CID 160760418) has the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. Its IUPAC name is 5-bromo-2-methoxy-2,3-dihydro-1H-indole.
| Compound Name | 5-bromo-2-methoxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 160760418 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 5-bromo-2-methoxy-2,3-dihydro-1H-indole |
| SMILES | COC1Cc2cc(Br)ccc2N1 |
| InChI | InChI=1S/C9H10BrNO/c1-12-9-5-6-4-7(10)2-3-8(6)11-9/h2-4,9,11H,5H2,1H3 |
| InChIKey | GJRDECYDTUKHAW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |