About (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane
(6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane (PubChem CID 160760666) has the molecular formula C15H24BrNO2Si
and a molecular weight of 358.35 g/mol. Its IUPAC name is (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane |
| PubChem CID | 160760666 |
| Molecular Formula | C15H24BrNO2Si |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane |
| SMILES | Cc1c(Br)cnc2c1C(O[Si](C)(C)C(C)(C)C)CCO2 |
| InChI | InChI=1S/C15H24BrNO2Si/c1-10-11(16)9-17-14-13(10)12(7-8-18-14)19-20(5,6)15(2,3)4/h9,12H,7-8H2,1-6H3 |
| InChIKey | RYAFELBLACDDAA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane?
The IUPAC name of (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane (CID 160760666) is (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane.
What is the SMILES notation for (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane?
The canonical SMILES for (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane is Cc1c(Br)cnc2c1C(O[Si](C)(C)C(C)(C)C)CCO2.
What is the InChIKey of (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane?
The InChIKey is RYAFELBLACDDAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24BrNO2Si/c1-10-11(16)9-17-14-13(10)12(7-8-18-14)19-20(5,6)15(2,3)4/h9,12H,7-8H2,1-6H3.
What are the key properties of (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane?
(6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane has a molecular weight of 358.35 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-5-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)oxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 160760666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).