About 4-bromo-1,2-dimethylbenzene;carbon dioxide
4-bromo-1,2-dimethylbenzene;carbon dioxide (PubChem CID 160763403) has the molecular formula C9H9BrO2
and a molecular weight of 229.07 g/mol. Its IUPAC name is 4-bromo-1,2-dimethylbenzene;carbon dioxide.
Molecular Properties
| Compound Name | 4-bromo-1,2-dimethylbenzene;carbon dioxide |
| PubChem CID | 160763403 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 4-bromo-1,2-dimethylbenzene;carbon dioxide |
| SMILES | Cc1ccc(Br)cc1C.O=C=O |
| InChI | InChI=1S/C8H9Br.CO2/c1-6-3-4-8(9)5-7(6)2;2-1-3/h3-5H,1-2H3; |
| InChIKey | RYJGMWLYDSVZBX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-1,2-dimethylbenzene;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,2-dimethylbenzene;carbon dioxide?
The IUPAC name of 4-bromo-1,2-dimethylbenzene;carbon dioxide (CID 160763403) is 4-bromo-1,2-dimethylbenzene;carbon dioxide.
What is the SMILES notation for 4-bromo-1,2-dimethylbenzene;carbon dioxide?
The canonical SMILES for 4-bromo-1,2-dimethylbenzene;carbon dioxide is Cc1ccc(Br)cc1C.O=C=O.
What is the InChIKey of 4-bromo-1,2-dimethylbenzene;carbon dioxide?
The InChIKey is RYJGMWLYDSVZBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Br.CO2/c1-6-3-4-8(9)5-7(6)2;2-1-3/h3-5H,1-2H3;.
What are the key properties of 4-bromo-1,2-dimethylbenzene;carbon dioxide?
4-bromo-1,2-dimethylbenzene;carbon dioxide has a molecular weight of 229.07 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,2-dimethylbenzene;carbon dioxide is sourced from PubChem (CID 160763403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).