C18H18BF4NO2 — CID 160764098
trifluoroborane;3,3,6-trimethyl-2,4-dihydrochromeno[3,4-b]indol-7-ium-1-one;fluoride (PubChem CID 160764098) has the molecular formula C18H18BF4NO2 and a molecular weight of 367.15 g/mol. Its IUPAC name is trifluoroborane;3,3,6-trimethyl-2,4-dihydrochromeno[3,4-b]indol-7-ium-1-one;fluoride.
| Compound Name | trifluoroborane;3,3,6-trimethyl-2,4-dihydrochromeno[3,4-b]indol-7-ium-1-one;fluoride |
|---|---|
| PubChem CID | 160764098 |
| Molecular Formula | C18H18BF4NO2 |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | trifluoroborane;3,3,6-trimethyl-2,4-dihydrochromeno[3,4-b]indol-7-ium-1-one;fluoride |
| SMILES | Cc1oc2c(c3c4ccccc4[nH+]c1-3)C(=O)CC(C)(C)C2.FB(F)F.[F-] |
| InChI | InChI=1S/C18H17NO2.BF3.FH/c1-10-17-15(11-6-4-5-7-12(11)19-17)16-13(20)8-18(2,3)9-14(16)21-10;2-1(3)4;/h4-7H,8-9H2,1-3H3;;1H |
| InChIKey | RYLMKLUJYSDFIG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|