About benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid)
benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid) (PubChem CID 160764621) has the molecular formula C19H20F6N2O4
and a molecular weight of 454.37 g/mol. Its IUPAC name is benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid).
Molecular Properties
| Compound Name | benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid) |
| PubChem CID | 160764621 |
| Molecular Formula | C19H20F6N2O4 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid) |
| SMILES | O=C(O)NCC(F)(F)F.O=C(O)NCC(F)(F)F.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.2C3H4F3NO2/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*4-3(5,6)1-7-2(8)9/h1-10H,11H2;2*7H,1H2,(H,8,9) |
| InChIKey | RYNCURLYGMKSNB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid)?
The IUPAC name of benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid) (CID 160764621) is benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid).
What is the SMILES notation for benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid)?
The canonical SMILES for benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid) is O=C(O)NCC(F)(F)F.O=C(O)NCC(F)(F)F.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid)?
The InChIKey is RYNCURLYGMKSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.2C3H4F3NO2/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*4-3(5,6)1-7-2(8)9/h1-10H,11H2;2*7H,1H2,(H,8,9).
What are the key properties of benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid)?
benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid) has a molecular weight of 454.37 g/mol, XLogP of 4.91, 4 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;bis(2,2,2-trifluoroethylcarbamic acid) is sourced from PubChem (CID 160764621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).