About methane;methoxyethane;2-methylprop-1-ene
methane;methoxyethane;2-methylprop-1-ene (PubChem CID 160764872) has the molecular formula C8H20O
and a molecular weight of 132.25 g/mol. Its IUPAC name is methane;methoxyethane;2-methylprop-1-ene.
Molecular Properties
| Compound Name | methane;methoxyethane;2-methylprop-1-ene |
| PubChem CID | 160764872 |
| Molecular Formula | C8H20O |
| Molecular Weight | 132.25 g/mol |
| Exact Mass | 132.15 |
| IUPAC Name | methane;methoxyethane;2-methylprop-1-ene |
| SMILES | C.C=C(C)C.CCOC |
| InChI | InChI=1S/C4H8.C3H8O.CH4/c1-4(2)3;1-3-4-2;/h1H2,2-3H3;3H2,1-2H3;1H4 |
| InChIKey | RYNWJGBPELMQFQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;methoxyethane;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methoxyethane;2-methylprop-1-ene?
The IUPAC name of methane;methoxyethane;2-methylprop-1-ene (CID 160764872) is methane;methoxyethane;2-methylprop-1-ene.
What is the SMILES notation for methane;methoxyethane;2-methylprop-1-ene?
The canonical SMILES for methane;methoxyethane;2-methylprop-1-ene is C.C=C(C)C.CCOC.
What is the InChIKey of methane;methoxyethane;2-methylprop-1-ene?
The InChIKey is RYNWJGBPELMQFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.C3H8O.CH4/c1-4(2)3;1-3-4-2;/h1H2,2-3H3;3H2,1-2H3;1H4.
What are the key properties of methane;methoxyethane;2-methylprop-1-ene?
methane;methoxyethane;2-methylprop-1-ene has a molecular weight of 132.25 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methoxyethane;2-methylprop-1-ene is sourced from PubChem (CID 160764872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).