About 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane
4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane (PubChem CID 160764980) has the molecular formula C18H24N4S2
and a molecular weight of 360.55 g/mol. Its IUPAC name is 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane.
Molecular Properties
| Compound Name | 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane |
| PubChem CID | 160764980 |
| Molecular Formula | C18H24N4S2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane |
| SMILES | CCCc1ccncc1C#N.CCCc1ccncc1C(N)=S.S |
| InChI | InChI=1S/C9H12N2S.C9H10N2.H2S/c1-2-3-7-4-5-11-6-8(7)9(10)12;1-2-3-8-4-5-11-7-9(8)6-10;/h4-6H,2-3H2,1H3,(H2,10,12);4-5,7H,2-3H2,1H3;1H2 |
| InChIKey | RYOFFSOVQQZRQP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane?
The IUPAC name of 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane (CID 160764980) is 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane.
What is the SMILES notation for 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane?
The canonical SMILES for 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane is CCCc1ccncc1C#N.CCCc1ccncc1C(N)=S.S.
What is the InChIKey of 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane?
The InChIKey is RYOFFSOVQQZRQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S.C9H10N2.H2S/c1-2-3-7-4-5-11-6-8(7)9(10)12;1-2-3-8-4-5-11-7-9(8)6-10;/h4-6H,2-3H2,1H3,(H2,10,12);4-5,7H,2-3H2,1H3;1H2.
What are the key properties of 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane?
4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane has a molecular weight of 360.55 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propylpyridine-3-carbonitrile;4-propylpyridine-3-carbothioamide;sulfane is sourced from PubChem (CID 160764980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).