About 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine
4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine (PubChem CID 160765658) has the molecular formula C17H35NO
and a molecular weight of 269.47 g/mol. Its IUPAC name is 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine |
| PubChem CID | 160765658 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine |
| SMILES | CC(C)C1CCOCC1.CC1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C9H19N.C8H16O/c1-8-4-6-9(7-5-8)10(2)3;1-7(2)8-3-5-9-6-4-8/h8-9H,4-7H2,1-3H3;7-8H,3-6H2,1-2H3 |
| InChIKey | RYQOYPWQBKGXJT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine?
The IUPAC name of 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine (CID 160765658) is 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine.
What is the SMILES notation for 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine?
The canonical SMILES for 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine is CC(C)C1CCOCC1.CC1CCC(N(C)C)CC1.
What is the InChIKey of 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine?
The InChIKey is RYQOYPWQBKGXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C8H16O/c1-8-4-6-9(7-5-8)10(2)3;1-7(2)8-3-5-9-6-4-8/h8-9H,4-7H2,1-3H3;7-8H,3-6H2,1-2H3.
What are the key properties of 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine?
4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine has a molecular weight of 269.47 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yloxane;N,N,4-trimethylcyclohexan-1-amine is sourced from PubChem (CID 160765658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).