C23H34N6O2 — CID 160768600
1-(6-methyl-3-pyridinyl)ethanone;piperazine;1-(6-piperazin-1-yl-3-pyridinyl)ethanone (PubChem CID 160768600) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 1-(6-methyl-3-pyridinyl)ethanone;piperazine;1-(6-piperazin-1-yl-3-pyridinyl)ethanone.
| Compound Name | 1-(6-methyl-3-pyridinyl)ethanone;piperazine;1-(6-piperazin-1-yl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 160768600 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 1-(6-methyl-3-pyridinyl)ethanone;piperazine;1-(6-piperazin-1-yl-3-pyridinyl)ethanone |
| SMILES | C1CNCCN1.CC(=O)c1ccc(C)nc1.CC(=O)c1ccc(N2CCNCC2)nc1 |
| InChI | InChI=1S/C11H15N3O.C8H9NO.C4H10N2/c1-9(15)10-2-3-11(13-8-10)14-6-4-12-5-7-14;1-6-3-4-8(5-9-6)7(2)10;1-2-6-4-3-5-1/h2-3,8,12H,4-7H2,1H3;3-5H,1-2H3;5-6H,1-4H2 |
| InChIKey | RZAAMKAQOYONIM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |