About 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane
1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane (PubChem CID 160769033) has the molecular formula C12H18ClNO2S
and a molecular weight of 275.80 g/mol. Its IUPAC name is 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane.
Molecular Properties
| Compound Name | 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane |
| PubChem CID | 160769033 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane |
| SMILES | C.C=S(=O)(CC)Nc1cccc(Cl)c1C(C)=O |
| InChI | InChI=1S/C11H14ClNO2S.CH4/c1-4-16(3,15)13-10-7-5-6-9(12)11(10)8(2)14;/h5-7H,3-4H2,1-2H3,(H,13,15);1H4 |
| InChIKey | RZBIESVKDDXACX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane?
The IUPAC name of 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane (CID 160769033) is 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane.
What is the SMILES notation for 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane?
The canonical SMILES for 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane is C.C=S(=O)(CC)Nc1cccc(Cl)c1C(C)=O.
What is the InChIKey of 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane?
The InChIKey is RZBIESVKDDXACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO2S.CH4/c1-4-16(3,15)13-10-7-5-6-9(12)11(10)8(2)14;/h5-7H,3-4H2,1-2H3,(H,13,15);1H4.
What are the key properties of 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane?
1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane has a molecular weight of 275.80 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-chloro-6-[(ethyl-methylidene-oxo-λ6-sulfanyl)amino]phenyl]ethanone;methane is sourced from PubChem (CID 160769033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).