C32H34F3IN4O2 — CID 160770900
5-ethynyl-1-(oxan-2-yl)indazole;iodoethane;1-(oxan-2-yl)-5-(4,4,4-trifluorobut-1-ynyl)indazole (PubChem CID 160770900) has the molecular formula C32H34F3IN4O2 and a molecular weight of 690.55 g/mol. Its IUPAC name is 5-ethynyl-1-(oxan-2-yl)indazole;iodoethane;1-(oxan-2-yl)-5-(4,4,4-trifluorobut-1-ynyl)indazole.
| Compound Name | 5-ethynyl-1-(oxan-2-yl)indazole;iodoethane;1-(oxan-2-yl)-5-(4,4,4-trifluorobut-1-ynyl)indazole |
|---|---|
| PubChem CID | 160770900 |
| Molecular Formula | C32H34F3IN4O2 |
| Molecular Weight | 690.55 g/mol |
| Exact Mass | 690.17 |
| IUPAC Name | 5-ethynyl-1-(oxan-2-yl)indazole;iodoethane;1-(oxan-2-yl)-5-(4,4,4-trifluorobut-1-ynyl)indazole |
| SMILES | C#Cc1ccc2c(cnn2C2CCCCO2)c1.CCI.FC(F)(F)CC#Cc1ccc2c(cnn2C2CCCCO2)c1 |
| InChI | InChI=1S/C16H15F3N2O.C14H14N2O.C2H5I/c17-16(18,19)8-3-4-12-6-7-14-13(10-12)11-20-21(14)15-5-1-2-9-22-15;1-2-11-6-7-13-12(9-11)10-15-16(13)14-5-3-4-8-17-14;1-2-3/h6-7,10-11,15H,1-2,5,8-9H2;1,6-7,9-10,14H,3-5,8H2;2H2,1H3 |
| InChIKey | RZHMKVDVXFSUEW-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.55 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|