C15H27N3O2S2 — CID 160771197
N-[[(3S,3aS,6aR)-5-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide;sulfane (PubChem CID 160771197) has the molecular formula C15H27N3O2S2 and a molecular weight of 345.53 g/mol. Its IUPAC name is N-[[(3S,3aS,6aR)-5-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide;sulfane.
| Compound Name | N-[[(3S,3aS,6aR)-5-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide;sulfane |
|---|---|
| PubChem CID | 160771197 |
| Molecular Formula | C15H27N3O2S2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[[(3S,3aS,6aR)-5-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide;sulfane |
| SMILES | Cc1noc(C)c1C(=O)NC[C@H]1NC[C@@H]2CC(C)C[C@@H]21.S.S |
| InChI | InChI=1S/C15H23N3O2.2H2S/c1-8-4-11-6-16-13(12(11)5-8)7-17-15(19)14-9(2)18-20-10(14)3;;/h8,11-13,16H,4-7H2,1-3H3,(H,17,19);2*1H2/t8?,11-,12-,13+;;/m0../s1 |
| InChIKey | RZIMEKNWIGQQBS-JLICCZCASA-N |
| XLogP | 1.88 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |