C15H17FN4O4S2 — CID 160771433
N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-(3-methylsulfonylpropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 160771433) has the molecular formula C15H17FN4O4S2 and a molecular weight of 400.46 g/mol. Its IUPAC name is N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-(3-methylsulfonylpropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-(3-methylsulfonylpropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 160771433 |
| Molecular Formula | C15H17FN4O4S2 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-(3-methylsulfonylpropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)(=O)CCCSc1nonc1/C(=N/C1Cc2c(F)cccc21)NO |
| InChI | InChI=1S/C15H17FN4O4S2/c1-26(22,23)7-3-6-25-15-13(19-24-20-15)14(18-21)17-12-8-10-9(12)4-2-5-11(10)16/h2,4-5,12,21H,3,6-8H2,1H3,(H,17,18) |
| InChIKey | RZJGWIAYUDELAO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|