About CID 160772379
CID 160772379 (PubChem CID 160772379) has the molecular formula H2Cl5CsORh
and a molecular weight of 431.09 g/mol.
Molecular Properties
| Compound Name | CID 160772379 |
| PubChem CID | 160772379 |
| Molecular Formula | H2Cl5CsORh |
| Molecular Weight | 431.09 g/mol |
| Exact Mass | 428.67 |
| IUPAC Name | — |
| SMILES | Cl[Rh](Cl)(Cl)(Cl)Cl.O.[Cs] |
| InChI | InChI=1S/5ClH.Cs.H2O.Rh/h5*1H;;1H2;/q;;;;;;;+5/p-5 |
| InChIKey | RZMJJUOTXAZRRP-UHFFFAOYSA-I |
| XLogP | 2.24 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.09 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 160772379 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160772379?
The IUPAC name of CID 160772379 (CID 160772379) is not available.
What is the SMILES notation for CID 160772379?
The canonical SMILES for CID 160772379 is Cl[Rh](Cl)(Cl)(Cl)Cl.O.[Cs].
What is the InChIKey of CID 160772379?
The InChIKey is RZMJJUOTXAZRRP-UHFFFAOYSA-I. The full InChI is InChI=1S/5ClH.Cs.H2O.Rh/h5*1H;;1H2;/q;;;;;;;+5/p-5.
What are the key properties of CID 160772379?
CID 160772379 has a molecular weight of 431.09 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160772379 is sourced from PubChem (CID 160772379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).