C25H30BNO6S — CID 160772668
2-methoxy-N-[2-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indene-3,1'-cyclobutane]-5-yl]benzenesulfonamide (PubChem CID 160772668) has the molecular formula C25H30BNO6S and a molecular weight of 483.40 g/mol. Its IUPAC name is 2-methoxy-N-[2-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indene-3,1'-cyclobutane]-5-yl]benzenesulfonamide.
| Compound Name | 2-methoxy-N-[2-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indene-3,1'-cyclobutane]-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 160772668 |
| Molecular Formula | C25H30BNO6S |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 2-methoxy-N-[2-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indene-3,1'-cyclobutane]-5-yl]benzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)Nc1cc(B2OC(C)(C)C(C)(C)O2)c2c(c1)C1(CCC1)C(=O)C2 |
| InChI | InChI=1S/C25H30BNO6S/c1-23(2)24(3,4)33-26(32-23)19-14-16(13-18-17(19)15-22(28)25(18)11-8-12-25)27-34(29,30)21-10-7-6-9-20(21)31-5/h6-7,9-10,13-14,27H,8,11-12,15H2,1-5H3 |
| InChIKey | UQVWCTJNLZPFRP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|