About 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane
3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane (PubChem CID 160774883) has the molecular formula C23H25ClFN3O
and a molecular weight of 413.92 g/mol. Its IUPAC name is 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane.
Molecular Properties
| Compound Name | 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane |
| PubChem CID | 160774883 |
| Molecular Formula | C23H25ClFN3O |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane |
| SMILES | C.CC(=O)NCc1cc2c(C)c[nH]c2cc1F.Cc1ccc2ncc(Cl)cc2c1 |
| InChI | InChI=1S/C12H13FN2O.C10H8ClN.CH4/c1-7-5-15-12-4-11(13)9(3-10(7)12)6-14-8(2)16;1-7-2-3-10-8(4-7)5-9(11)6-12-10;/h3-5,15H,6H2,1-2H3,(H,14,16);2-6H,1H3;1H4 |
| InChIKey | RZUVCWVHFPHJDN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane?
The IUPAC name of 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane (CID 160774883) is 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane.
What is the SMILES notation for 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane?
The canonical SMILES for 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane is C.CC(=O)NCc1cc2c(C)c[nH]c2cc1F.Cc1ccc2ncc(Cl)cc2c1.
What is the InChIKey of 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane?
The InChIKey is RZUVCWVHFPHJDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O.C10H8ClN.CH4/c1-7-5-15-12-4-11(13)9(3-10(7)12)6-14-8(2)16;1-7-2-3-10-8(4-7)5-9(11)6-12-10;/h3-5,15H,6H2,1-2H3,(H,14,16);2-6H,1H3;1H4.
What are the key properties of 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane?
3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane has a molecular weight of 413.92 g/mol, XLogP of 6.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-methylquinoline;N-[(6-fluoro-3-methyl-1H-indol-5-yl)methyl]acetamide;methane is sourced from PubChem (CID 160774883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).