C37H36F6N4O6 — CID 160775201
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(3,5-dimethylphenoxy)-5-ethylpyrimidine-2,4-dione;6-(3,5-dimethylphenoxy)-5-ethyl-1H-pyrimidine-2,4-dione (PubChem CID 160775201) has the molecular formula C37H36F6N4O6 and a molecular weight of 746.70 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(3,5-dimethylphenoxy)-5-ethylpyrimidine-2,4-dione;6-(3,5-dimethylphenoxy)-5-ethyl-1H-pyrimidine-2,4-dione.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(3,5-dimethylphenoxy)-5-ethylpyrimidine-2,4-dione;6-(3,5-dimethylphenoxy)-5-ethyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 160775201 |
| Molecular Formula | C37H36F6N4O6 |
| Molecular Weight | 746.70 g/mol |
| Exact Mass | 746.25 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(3,5-dimethylphenoxy)-5-ethylpyrimidine-2,4-dione;6-(3,5-dimethylphenoxy)-5-ethyl-1H-pyrimidine-2,4-dione |
| SMILES | CCc1c(Oc2cc(C)cc(C)c2)[nH]c(=O)[nH]c1=O.CCc1c(Oc2cc(C)cc(C)c2)n(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H20F6N2O3.C14H16N2O3/c1-4-18-19(32)30-21(33)31(20(18)34-17-6-12(2)5-13(3)7-17)11-14-8-15(22(24,25)26)10-16(9-14)23(27,28)29;1-4-11-12(17)15-14(18)16-13(11)19-10-6-8(2)5-9(3)7-10/h5-10H,4,11H2,1-3H3,(H,30,32,33);5-7H,4H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | RZVUQWHMHSOTBV-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.70 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |