C25H37N7O2SSi — CID 160775920
N-[7-(1-amino-1-ethoxy-3-methyliminoprop-1-en-2-yl)-1,5-naphthyridin-2-yl]-5-propan-2-yl-N-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 160775920) has the molecular formula C25H37N7O2SSi and a molecular weight of 527.77 g/mol. Its IUPAC name is N-[7-(1-amino-1-ethoxy-3-methyliminoprop-1-en-2-yl)-1,5-naphthyridin-2-yl]-5-propan-2-yl-N-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[7-(1-amino-1-ethoxy-3-methyliminoprop-1-en-2-yl)-1,5-naphthyridin-2-yl]-5-propan-2-yl-N-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 160775920 |
| Molecular Formula | C25H37N7O2SSi |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | N-[7-(1-amino-1-ethoxy-3-methyliminoprop-1-en-2-yl)-1,5-naphthyridin-2-yl]-5-propan-2-yl-N-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCOC(N)=C(/C=N/C)c1cnc2ccc(N(COCC[Si](C)(C)C)c3nnc(C(C)C)s3)nc2c1 |
| InChI | InChI=1S/C25H37N7O2SSi/c1-8-34-23(26)19(15-27-4)18-13-21-20(28-14-18)9-10-22(29-21)32(16-33-11-12-36(5,6)7)25-31-30-24(35-25)17(2)3/h9-10,13-15,17H,8,11-12,16,26H2,1-7H3/b23-19?,27-15+ |
| InChIKey | OWAMPVJIQKVAJU-ACXOAGICSA-N |
| XLogP | 5.42 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|