C20H30F14OSn — CID 160777229
bis(2,2,3,3,4,4,4-heptafluorobutyl)tin;1-hexoxyhexane (PubChem CID 160777229) has the molecular formula C20H30F14OSn and a molecular weight of 671.14 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,4-heptafluorobutyl)tin;1-hexoxyhexane.
| Compound Name | bis(2,2,3,3,4,4,4-heptafluorobutyl)tin;1-hexoxyhexane |
|---|---|
| PubChem CID | 160777229 |
| Molecular Formula | C20H30F14OSn |
| Molecular Weight | 671.14 g/mol |
| Exact Mass | 672.11 |
| IUPAC Name | bis(2,2,3,3,4,4,4-heptafluorobutyl)tin;1-hexoxyhexane |
| SMILES | CCCCCCOCCCCCC.FC(F)(F)C(F)(F)C(F)(F)C[Sn]CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H26O.2C4H2F7.Sn/c1-3-5-7-9-11-13-12-10-8-6-4-2;2*1-2(5,6)3(7,8)4(9,10)11;/h3-12H2,1-2H3;2*1H2; |
| InChIKey | SACJPOIFVDAVPJ-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.14 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|