C19H40O5S — CID 160777826
tridecyl prop-2-enoate;trihydroxy(propyl)-λ4-sulfane (PubChem CID 160777826) has the molecular formula C19H40O5S and a molecular weight of 380.59 g/mol. Its IUPAC name is tridecyl prop-2-enoate;trihydroxy(propyl)-λ4-sulfane.
| Compound Name | tridecyl prop-2-enoate;trihydroxy(propyl)-λ4-sulfane |
|---|---|
| PubChem CID | 160777826 |
| Molecular Formula | C19H40O5S |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | tridecyl prop-2-enoate;trihydroxy(propyl)-λ4-sulfane |
| SMILES | C=CC(=O)OCCCCCCCCCCCCC.CCCS(O)(O)O |
| InChI | InChI=1S/C16H30O2.C3H10O3S/c1-3-5-6-7-8-9-10-11-12-13-14-15-18-16(17)4-2;1-2-3-7(4,5)6/h4H,2-3,5-15H2,1H3;4-6H,2-3H2,1H3 |
| InChIKey | SAEJZJCTJNPHTF-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|