About 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+)
1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+) (PubChem CID 160778051) has the molecular formula C12H9BrFe
and a molecular weight of 288.95 g/mol. Its IUPAC name is 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+).
Molecular Properties
| Compound Name | 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+) |
| PubChem CID | 160778051 |
| Molecular Formula | C12H9BrFe |
| Molecular Weight | 288.95 g/mol |
| Exact Mass | 287.92 |
| IUPAC Name | 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+) |
| SMILES | Brc1ccc[cH-]1.C#Cc1ccc[cH-]1.[Fe+2] |
| InChI | InChI=1S/C7H5.C5H4Br.Fe/c1-2-7-5-3-4-6-7;6-5-3-1-2-4-5;/h1,3-6H;1-4H;/q2*-1;+2 |
| InChIKey | SAFCKDKZGOLLKR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.95 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+)?
The IUPAC name of 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+) (CID 160778051) is 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+).
What is the SMILES notation for 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+)?
The canonical SMILES for 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+) is Brc1ccc[cH-]1.C#Cc1ccc[cH-]1.[Fe+2].
What is the InChIKey of 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+)?
The InChIKey is SAFCKDKZGOLLKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5.C5H4Br.Fe/c1-2-7-5-3-4-6-7;6-5-3-1-2-4-5;/h1,3-6H;1-4H;/q2*-1;+2.
What are the key properties of 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+)?
1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+) has a molecular weight of 288.95 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromocyclopenta-1,3-diene;1-ethynylcyclopenta-1,3-diene;iron(2+) is sourced from PubChem (CID 160778051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).