About biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium
biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium (PubChem CID 160779870) has the molecular formula C12H10O5P2+2
and a molecular weight of 296.15 g/mol. Its IUPAC name is biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium.
Molecular Properties
| Compound Name | biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium |
| PubChem CID | 160779870 |
| Molecular Formula | C12H10O5P2+2 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium |
| SMILES | O=[P+](O)O[P+](=O)O.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.O5P2/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-6(2)5-7(3)4/h1-8H;/p+2 |
| InChIKey | IQNYOAMTUNKNAB-UHFFFAOYSA-P |
| XLogP | 3.64 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium?
The IUPAC name of biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium (CID 160779870) is biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium.
What is the SMILES notation for biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium?
The canonical SMILES for biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium is O=[P+](O)O[P+](=O)O.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium?
The InChIKey is IQNYOAMTUNKNAB-UHFFFAOYSA-P. The full InChI is InChI=1S/C12H8.O5P2/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-6(2)5-7(3)4/h1-8H;/p+2.
What are the key properties of biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium?
biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium has a molecular weight of 296.15 g/mol, XLogP of 3.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium is sourced from PubChem (CID 160779870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).