C30H38O7 — CID 160780156
(2-ethyl-2-adamantyl) 2-methylprop-2-enoate;furan-2,5-dione;spiro[bicyclo[2.2.1]hept-2-ene-5,4'-oxolane]-2'-one (PubChem CID 160780156) has the molecular formula C30H38O7 and a molecular weight of 510.63 g/mol. Its IUPAC name is (2-ethyl-2-adamantyl) 2-methylprop-2-enoate;furan-2,5-dione;spiro[bicyclo[2.2.1]hept-2-ene-5,4'-oxolane]-2'-one.
| Compound Name | (2-ethyl-2-adamantyl) 2-methylprop-2-enoate;furan-2,5-dione;spiro[bicyclo[2.2.1]hept-2-ene-5,4'-oxolane]-2'-one |
|---|---|
| PubChem CID | 160780156 |
| Molecular Formula | C30H38O7 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | (2-ethyl-2-adamantyl) 2-methylprop-2-enoate;furan-2,5-dione;spiro[bicyclo[2.2.1]hept-2-ene-5,4'-oxolane]-2'-one |
| SMILES | C=C(C)C(=O)OC1(CC)C2CC3CC(C2)CC1C3.O=C1C=CC(=O)O1.O=C1CC2(CO1)CC1C=CC2C1 |
| InChI | InChI=1S/C16H24O2.C10H12O2.C4H2O3/c1-4-16(18-15(17)10(2)3)13-6-11-5-12(8-13)9-14(16)7-11;11-9-5-10(6-12-9)4-7-1-2-8(10)3-7;5-3-1-2-4(6)7-3/h11-14H,2,4-9H2,1,3H3;1-2,7-8H,3-6H2;1-2H |
| InChIKey | SALWARNFHGHFHN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|