C25H27N5O3 — CID 160780907
tert-butyl 2-[2-[[4-(6-amino-3H-indol-2-yl)phenyl]carbamoyl]-1-methylimidazol-4-yl]acetate (PubChem CID 160780907) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is tert-butyl 2-[2-[[4-(6-amino-3H-indol-2-yl)phenyl]carbamoyl]-1-methylimidazol-4-yl]acetate.
| Compound Name | tert-butyl 2-[2-[[4-(6-amino-3H-indol-2-yl)phenyl]carbamoyl]-1-methylimidazol-4-yl]acetate |
|---|---|
| PubChem CID | 160780907 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | tert-butyl 2-[2-[[4-(6-amino-3H-indol-2-yl)phenyl]carbamoyl]-1-methylimidazol-4-yl]acetate |
| SMILES | Cn1cc(CC(=O)OC(C)(C)C)nc1C(=O)Nc1ccc(C2=Nc3cc(N)ccc3C2)cc1 |
| InChI | InChI=1S/C25H27N5O3/c1-25(2,3)33-22(31)13-19-14-30(4)23(27-19)24(32)28-18-9-6-15(7-10-18)20-11-16-5-8-17(26)12-21(16)29-20/h5-10,12,14H,11,13,26H2,1-4H3,(H,28,32) |
| InChIKey | QJRSHZKINDZOGA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|