About CID 160781562
CID 160781562 (PubChem CID 160781562) has the molecular formula C44H27B50ClN2
and a molecular weight of 1159.77 g/mol.
Molecular Properties
| Compound Name | CID 160781562 |
| PubChem CID | 160781562 |
| Molecular Formula | C44H27B50ClN2 |
| Molecular Weight | 1159.77 g/mol |
| Exact Mass | 1168.65 |
| IUPAC Name | — |
| SMILES | Clc1cc(-c2ccccc2-c2cnc3c(ccc4ccccc43)c2)cc(-c2ccccc2-c2cnc3c(ccc4ccccc43)c2)c1.[B]B([B])B(B([B])[B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C44H27ClN2.B50/c45-36-24-32(37-11-5-7-13-39(37)34-21-30-19-17-28-9-1-3-15-41(28)43(30)46-26-34)23-33(25-36)38-12-6-8-14-40(38)35-22-31-20-18-29-10-2-4-16-42(29)44(31)47-27-35;1-27(2)40(28(3)4)46(39(25)26)49(45(37(21)22)38(23)24)50(47(41(29(5)6)30(7)8)42(31(9)10)32(11)12)48(43(33(13)14)34(15)16)44(35(17)18)36(19)20/h1-27H; |
| InChIKey | UOTGRBJPHUZQBH-UHFFFAOYSA-N |
| XLogP | -6.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 97 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1159.77 |
| LogP ≤ 5 | -6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 160781562 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160781562?
The IUPAC name of CID 160781562 (CID 160781562) is not available.
What is the SMILES notation for CID 160781562?
The canonical SMILES for CID 160781562 is Clc1cc(-c2ccccc2-c2cnc3c(ccc4ccccc43)c2)cc(-c2ccccc2-c2cnc3c(ccc4ccccc43)c2)c1.[B]B([B])B(B([B])[B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B].
What is the InChIKey of CID 160781562?
The InChIKey is UOTGRBJPHUZQBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H27ClN2.B50/c45-36-24-32(37-11-5-7-13-39(37)34-21-30-19-17-28-9-1-3-15-41(28)43(30)46-26-34)23-33(25-36)38-12-6-8-14-40(38)35-22-31-20-18-29-10-2-4-16-42(29)44(31)47-27-35;1-27(2)40(28(3)4)46(39(25)26)49(45(37(21)22)38(23)24)50(47(41(29(5)6)30(7)8)42(31(9)10)32(11)12)48(43(33(13)14)34(15)16)44(35(17)18)36(19)20/h1-27H;.
What are the key properties of CID 160781562?
CID 160781562 has a molecular weight of 1159.77 g/mol, XLogP of -6.63, 27 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160781562 is sourced from PubChem (CID 160781562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).