About (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne
(E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne (PubChem CID 160782894) has the molecular formula C12H21Br
and a molecular weight of 245.20 g/mol. Its IUPAC name is (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne.
Molecular Properties
| Compound Name | (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne |
| PubChem CID | 160782894 |
| Molecular Formula | C12H21Br |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne |
| SMILES | C#CC(C)(C)C.CC(C)(C)/C=C/Br |
| InChI | InChI=1S/C6H11Br.C6H10/c1-6(2,3)4-5-7;1-5-6(2,3)4/h4-5H,1-3H3;1H,2-4H3/b5-4+; |
| InChIKey | SAUVPEJGQZGVLI-FXRZFVDSSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne?
The IUPAC name of (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne (CID 160782894) is (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne.
What is the SMILES notation for (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne?
The canonical SMILES for (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne is C#CC(C)(C)C.CC(C)(C)/C=C/Br.
What is the InChIKey of (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne?
The InChIKey is SAUVPEJGQZGVLI-FXRZFVDSSA-N. The full InChI is InChI=1S/C6H11Br.C6H10/c1-6(2,3)4-5-7;1-5-6(2,3)4/h4-5H,1-3H3;1H,2-4H3/b5-4+;.
What are the key properties of (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne?
(E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne has a molecular weight of 245.20 g/mol, XLogP of 4.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-bromo-3,3-dimethylbut-1-ene;3,3-dimethylbut-1-yne is sourced from PubChem (CID 160782894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).