About 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one
4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one (PubChem CID 160784623) has the molecular formula C27H23ClN4O7
and a molecular weight of 550.96 g/mol. Its IUPAC name is 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one.
Molecular Properties
| Compound Name | 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one |
| PubChem CID | 160784623 |
| Molecular Formula | C27H23ClN4O7 |
| Molecular Weight | 550.96 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one |
| SMILES | CC(=O)c1ccc(-n2nn[nH]c2=O)cc1.CC(=O)c1ccc(C(=O)Cl)cc1.CC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H7ClO2.C9H8N4O2.C9H8O3/c1-6(11)7-2-4-8(5-3-7)9(10)12;1-6(14)7-2-4-8(5-3-7)13-9(15)10-11-12-13;1-6(10)7-2-4-8(5-3-7)9(11)12/h2-5H,1H3;2-5H,1H3,(H,10,12,15);2-5H,1H3,(H,11,12) |
| InChIKey | SBAUEZURINJLAP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 169.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 550.96 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one?
The IUPAC name of 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one (CID 160784623) is 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one.
What is the SMILES notation for 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one?
The canonical SMILES for 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one is CC(=O)c1ccc(-n2nn[nH]c2=O)cc1.CC(=O)c1ccc(C(=O)Cl)cc1.CC(=O)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one?
The InChIKey is SBAUEZURINJLAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO2.C9H8N4O2.C9H8O3/c1-6(11)7-2-4-8(5-3-7)9(10)12;1-6(14)7-2-4-8(5-3-7)13-9(15)10-11-12-13;1-6(10)7-2-4-8(5-3-7)9(11)12/h2-5H,1H3;2-5H,1H3,(H,10,12,15);2-5H,1H3,(H,11,12).
What are the key properties of 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one?
4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one has a molecular weight of 550.96 g/mol, XLogP of 4.01, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetylbenzoic acid;4-acetylbenzoyl chloride;4-(4-acetylphenyl)-1H-tetrazol-5-one is sourced from PubChem (CID 160784623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).