C19H26BN5O2 — CID 160784934
3-(2-methylpyrazol-3-yl)pyridine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 160784934) has the molecular formula C19H26BN5O2 and a molecular weight of 367.26 g/mol. Its IUPAC name is 3-(2-methylpyrazol-3-yl)pyridine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 3-(2-methylpyrazol-3-yl)pyridine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 160784934 |
| Molecular Formula | C19H26BN5O2 |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 3-(2-methylpyrazol-3-yl)pyridine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cn1nccc1-c1cccnc1.Cn1nccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H17BN2O2.C9H9N3/c1-9(2)10(3,4)15-11(14-9)8-6-7-12-13(8)5;1-12-9(4-6-11-12)8-3-2-5-10-7-8/h6-7H,1-5H3;2-7H,1H3 |
| InChIKey | SBBRVPMDOHLMOZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|