About 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine
5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine (PubChem CID 160785204) has the molecular formula C10H9BrCl2N4
and a molecular weight of 336.02 g/mol. Its IUPAC name is 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine |
| PubChem CID | 160785204 |
| Molecular Formula | C10H9BrCl2N4 |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine |
| SMILES | Nc1ncc(Br)cc1Cl.Nc1ncccc1Cl |
| InChI | InChI=1S/C5H4BrClN2.C5H5ClN2/c6-3-1-4(7)5(8)9-2-3;6-4-2-1-3-8-5(4)7/h1-2H,(H2,8,9);1-3H,(H2,7,8) |
| InChIKey | SBCMTBPNDKLKHD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine?
The IUPAC name of 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine (CID 160785204) is 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine.
What is the SMILES notation for 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine?
The canonical SMILES for 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine is Nc1ncc(Br)cc1Cl.Nc1ncccc1Cl.
What is the InChIKey of 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine?
The InChIKey is SBCMTBPNDKLKHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrClN2.C5H5ClN2/c6-3-1-4(7)5(8)9-2-3;6-4-2-1-3-8-5(4)7/h1-2H,(H2,8,9);1-3H,(H2,7,8).
What are the key properties of 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine?
5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine has a molecular weight of 336.02 g/mol, XLogP of 3.40, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-chloropyridin-2-amine;3-chloropyridin-2-amine is sourced from PubChem (CID 160785204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).