About 1,1-diethoxyhydrazine
1,1-diethoxyhydrazine (PubChem CID 160785529) has the molecular formula C4H12N2O2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 1,1-diethoxyhydrazine.
Molecular Properties
| Compound Name | 1,1-diethoxyhydrazine |
| PubChem CID | 160785529 |
| Molecular Formula | C4H12N2O2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 1,1-diethoxyhydrazine |
| SMILES | CCON(N)OCC |
| InChI | InChI=1S/C4H12N2O2/c1-3-7-6(5)8-4-2/h3-5H2,1-2H3 |
| InChIKey | SBDPHBBBFCRTEX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxyhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxyhydrazine?
The IUPAC name of 1,1-diethoxyhydrazine (CID 160785529) is 1,1-diethoxyhydrazine.
What is the SMILES notation for 1,1-diethoxyhydrazine?
The canonical SMILES for 1,1-diethoxyhydrazine is CCON(N)OCC.
What is the InChIKey of 1,1-diethoxyhydrazine?
The InChIKey is SBDPHBBBFCRTEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2O2/c1-3-7-6(5)8-4-2/h3-5H2,1-2H3.
What are the key properties of 1,1-diethoxyhydrazine?
1,1-diethoxyhydrazine has a molecular weight of 120.15 g/mol, XLogP of 0.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxyhydrazine is sourced from PubChem (CID 160785529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).