C14H19NO9 — CID 160786037
2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)acetonitrile;(2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid (PubChem CID 160786037) has the molecular formula C14H19NO9 and a molecular weight of 345.30 g/mol. Its IUPAC name is 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)acetonitrile;(2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid.
| Compound Name | 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)acetonitrile;(2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 160786037 |
| Molecular Formula | C14H19NO9 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)acetonitrile;(2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
| SMILES | N#CC(O)C1(O)C=CC=CC1.O=C(O)[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H9NO2.C6H10O7/c9-6-7(10)8(11)4-2-1-3-5-8;7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,7,10-11H,5H2;1-4,6-9,12H,(H,10,11)/t;1-,2-,3+,4-,6+/m.0/s1 |
| InChIKey | SBFIOXWXHVSPDN-HTJLRXQKSA-N |
| XLogP | -3.01 |
| TPSA | 191.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|