C34H35F2N3O5 — CID 160787564
(3R,4R)-4-cyclopentyl-3-[(3,5-difluorophenyl)methyl]-4-hydroxy-1-[3-[(2R)-2-(4-methyl-1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]-5-(1,3-oxazol-2-yl)phenyl]butan-1-one (PubChem CID 160787564) has the molecular formula C34H35F2N3O5 and a molecular weight of 603.67 g/mol. Its IUPAC name is (3R,4R)-4-cyclopentyl-3-[(3,5-difluorophenyl)methyl]-4-hydroxy-1-[3-[(2R)-2-(4-methyl-1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]-5-(1,3-oxazol-2-yl)phenyl]butan-1-one.
| Compound Name | (3R,4R)-4-cyclopentyl-3-[(3,5-difluorophenyl)methyl]-4-hydroxy-1-[3-[(2R)-2-(4-methyl-1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]-5-(1,3-oxazol-2-yl)phenyl]butan-1-one |
|---|---|
| PubChem CID | 160787564 |
| Molecular Formula | C34H35F2N3O5 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | (3R,4R)-4-cyclopentyl-3-[(3,5-difluorophenyl)methyl]-4-hydroxy-1-[3-[(2R)-2-(4-methyl-1,3-oxazol-2-yl)pyrrolidine-1-carbonyl]-5-(1,3-oxazol-2-yl)phenyl]butan-1-one |
| SMILES | Cc1coc([C@H]2CCCN2C(=O)c2cc(C(=O)C[C@@H](Cc3cc(F)cc(F)c3)[C@H](O)C3CCCC3)cc(-c3ncco3)c2)n1 |
| InChI | InChI=1S/C34H35F2N3O5/c1-20-19-44-33(38-20)29-7-4-9-39(29)34(42)26-15-23(14-25(16-26)32-37-8-10-43-32)30(40)17-24(31(41)22-5-2-3-6-22)11-21-12-27(35)18-28(36)13-21/h8,10,12-16,18-19,22,24,29,31,41H,2-7,9,11,17H2,1H3/t24-,29-,31-/m1/s1 |
| InChIKey | SBKGNMYRDBXZAB-FGPAUOPCSA-N |
| XLogP | 6.88 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |