About 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole
2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole (PubChem CID 160790118) has the molecular formula C23H17F2NO3S
and a molecular weight of 425.46 g/mol. Its IUPAC name is 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole |
| PubChem CID | 160790118 |
| Molecular Formula | C23H17F2NO3S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole |
| SMILES | Cc1ccc(-c2ncco2)cc1-c1ccc(CS(=O)(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C23H17F2NO3S/c1-15-5-8-18(23-26-11-12-29-23)13-19(15)17-9-6-16(7-10-17)14-30(27,28)22-20(24)3-2-4-21(22)25/h2-13H,14H2,1H3 |
| InChIKey | SBSLZJFNVIMXNN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole?
The IUPAC name of 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole (CID 160790118) is 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole.
What is the SMILES notation for 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole?
The canonical SMILES for 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole is Cc1ccc(-c2ncco2)cc1-c1ccc(CS(=O)(=O)c2c(F)cccc2F)cc1.
What is the InChIKey of 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole?
The InChIKey is SBSLZJFNVIMXNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F2NO3S/c1-15-5-8-18(23-26-11-12-29-23)13-19(15)17-9-6-16(7-10-17)14-30(27,28)22-20(24)3-2-4-21(22)25/h2-13H,14H2,1H3.
What are the key properties of 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole?
2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole has a molecular weight of 425.46 g/mol, XLogP of 5.57, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-[(2,6-difluorophenyl)sulfonylmethyl]phenyl]-4-methylphenyl]-1,3-oxazole is sourced from PubChem (CID 160790118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).