About 4-tert-butyl-1H-pyridin-2-one;ethane
4-tert-butyl-1H-pyridin-2-one;ethane (PubChem CID 160791376) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-tert-butyl-1H-pyridin-2-one;ethane.
Molecular Properties
| Compound Name | 4-tert-butyl-1H-pyridin-2-one;ethane |
| PubChem CID | 160791376 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-tert-butyl-1H-pyridin-2-one;ethane |
| SMILES | CC.CC(C)(C)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C9H13NO.C2H6/c1-9(2,3)7-4-5-10-8(11)6-7;1-2/h4-6H,1-3H3,(H,10,11);1-2H3 |
| InChIKey | SBWDWRHWSIQTMR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-1H-pyridin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1H-pyridin-2-one;ethane?
The IUPAC name of 4-tert-butyl-1H-pyridin-2-one;ethane (CID 160791376) is 4-tert-butyl-1H-pyridin-2-one;ethane.
What is the SMILES notation for 4-tert-butyl-1H-pyridin-2-one;ethane?
The canonical SMILES for 4-tert-butyl-1H-pyridin-2-one;ethane is CC.CC(C)(C)c1cc[nH]c(=O)c1.
What is the InChIKey of 4-tert-butyl-1H-pyridin-2-one;ethane?
The InChIKey is SBWDWRHWSIQTMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.C2H6/c1-9(2,3)7-4-5-10-8(11)6-7;1-2/h4-6H,1-3H3,(H,10,11);1-2H3.
What are the key properties of 4-tert-butyl-1H-pyridin-2-one;ethane?
4-tert-butyl-1H-pyridin-2-one;ethane has a molecular weight of 181.28 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1H-pyridin-2-one;ethane is sourced from PubChem (CID 160791376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).