C18H26N4O2 — CID 160792289
6-methyl-4-[5-(4-methylpiperazin-1-yl)pentanoyl]-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 160792289) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 6-methyl-4-[5-(4-methylpiperazin-1-yl)pentanoyl]-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 6-methyl-4-[5-(4-methylpiperazin-1-yl)pentanoyl]-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 160792289 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 6-methyl-4-[5-(4-methylpiperazin-1-yl)pentanoyl]-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | CN1CCN(CCCCC(=O)c2cn(C)c(=O)c3[nH]ccc23)CC1 |
| InChI | InChI=1S/C18H26N4O2/c1-20-9-11-22(12-10-20)8-4-3-5-16(23)15-13-21(2)18(24)17-14(15)6-7-19-17/h6-7,13,19H,3-5,8-12H2,1-2H3 |
| InChIKey | BEQHUUHDHBUGTN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|