C27H34N4O8 — CID 160792900
methyl (2S)-2,7-dimethyl-6-[(3R)-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]pyrrolidin-1-yl]-8-nitro-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate (PubChem CID 160792900) has the molecular formula C27H34N4O8 and a molecular weight of 542.59 g/mol. Its IUPAC name is methyl (2S)-2,7-dimethyl-6-[(3R)-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]pyrrolidin-1-yl]-8-nitro-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate.
| Compound Name | methyl (2S)-2,7-dimethyl-6-[(3R)-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]pyrrolidin-1-yl]-8-nitro-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 160792900 |
| Molecular Formula | C27H34N4O8 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | methyl (2S)-2,7-dimethyl-6-[(3R)-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]pyrrolidin-1-yl]-8-nitro-12-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate |
| SMILES | COC(=O)c1cc2c([N+](=O)[O-])c(C)c(N3CC[C@@H](C4(NC(=O)OC(C)(C)C)CC4)C3)c3c2n(c1=O)[C@@H](C)CO3 |
| InChI | InChI=1S/C27H34N4O8/c1-14-13-38-22-20(29-10-7-16(12-29)27(8-9-27)28-25(34)39-26(3,4)5)15(2)19(31(35)36)17-11-18(24(33)37-6)23(32)30(14)21(17)22/h11,14,16H,7-10,12-13H2,1-6H3,(H,28,34)/t14-,16+/m0/s1 |
| InChIKey | YGDMCQCBVLISQB-GOEBONIOSA-N |
| XLogP | 3.84 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|